C30H63NS4 — CID 160878782
10-[10,10-bis(sulfanyl)decyl-decylamino]decane-1,1-dithiol (PubChem CID 160878782) has the molecular formula C30H63NS4 and a molecular weight of 566.11 g/mol. Its IUPAC name is 10-[10,10-bis(sulfanyl)decyl-decylamino]decane-1,1-dithiol.
| Compound Name | 10-[10,10-bis(sulfanyl)decyl-decylamino]decane-1,1-dithiol |
|---|---|
| PubChem CID | 160878782 |
| Molecular Formula | C30H63NS4 |
| Molecular Weight | 566.11 g/mol |
| Exact Mass | 565.38 |
| IUPAC Name | 10-[10,10-bis(sulfanyl)decyl-decylamino]decane-1,1-dithiol |
| SMILES | CCCCCCCCCCN(CCCCCCCCCC(S)S)CCCCCCCCCC(S)S |
| InChI | InChI=1S/C30H63NS4/c1-2-3-4-5-6-11-16-21-26-31(27-22-17-12-7-9-14-19-24-29(32)33)28-23-18-13-8-10-15-20-25-30(34)35/h29-30,32-35H,2-28H2,1H3 |
| InChIKey | SMTHWINRUZVMTE-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.11 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|