C6H8N2 — CID 165093546
(3Z)-hexa-1,3-dien-5-yne-1,1-diamine (PubChem CID 165093546) has the molecular formula C6H8N2 and a molecular weight of 108.14 g/mol. Its IUPAC name is (3Z)-hexa-1,3-dien-5-yne-1,1-diamine.
| Compound Name | (3Z)-hexa-1,3-dien-5-yne-1,1-diamine |
|---|---|
| PubChem CID | 165093546 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | (3Z)-hexa-1,3-dien-5-yne-1,1-diamine |
| SMILES | C#C/C=C\C=C(N)N |
| InChI | InChI=1S/C6H8N2/c1-2-3-4-5-6(7)8/h1,3-5H,7-8H2/b4-3- |
| InChIKey | XCRKXDGQJNEAGS-ARJAWSKDSA-N |
| XLogP | -0.07 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|