C5H12N4O — CID 163595878
N-[(2E)-1,5,5-triaminopenta-2,4-dienyl]hydroxylamine (PubChem CID 163595878) has the molecular formula C5H12N4O and a molecular weight of 144.18 g/mol. Its IUPAC name is N-[(2E)-1,5,5-triaminopenta-2,4-dienyl]hydroxylamine.
| Compound Name | N-[(2E)-1,5,5-triaminopenta-2,4-dienyl]hydroxylamine |
|---|---|
| PubChem CID | 163595878 |
| Molecular Formula | C5H12N4O |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | N-[(2E)-1,5,5-triaminopenta-2,4-dienyl]hydroxylamine |
| SMILES | NC(N)=C/C=C/C(N)NO |
| InChI | InChI=1S/C5H12N4O/c6-4(7)2-1-3-5(8)9-10/h1-3,5,9-10H,6-8H2/b3-1+ |
| InChIKey | GTJQDXRBZMNREE-HNQUOIGGSA-N |
| XLogP | -1.43 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|