C7H9N — CID 145347359
(3Z,5Z)-hepta-3,5-dien-1-yn-3-amine (PubChem CID 145347359) has the molecular formula C7H9N and a molecular weight of 107.16 g/mol. Its IUPAC name is (3Z,5Z)-hepta-3,5-dien-1-yn-3-amine.
| Compound Name | (3Z,5Z)-hepta-3,5-dien-1-yn-3-amine |
|---|---|
| PubChem CID | 145347359 |
| Molecular Formula | C7H9N |
| Molecular Weight | 107.16 g/mol |
| Exact Mass | 107.07 |
| IUPAC Name | (3Z,5Z)-hepta-3,5-dien-1-yn-3-amine |
| SMILES | C#C/C(N)=C/C=C\C |
| InChI | InChI=1S/C7H9N/c1-3-5-6-7(8)4-2/h2-3,5-6H,8H2,1H3/b5-3-,7-6- |
| InChIKey | ZFPXCEIHBYKPOI-VKLRWAGZSA-N |
| XLogP | 1.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 107.16 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|