C8H11N — CID 167215613
(3E)-6-methylhepta-3,5-dien-1-yn-3-amine (PubChem CID 167215613) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is (3E)-6-methylhepta-3,5-dien-1-yn-3-amine.
| Compound Name | (3E)-6-methylhepta-3,5-dien-1-yn-3-amine |
|---|---|
| PubChem CID | 167215613 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | (3E)-6-methylhepta-3,5-dien-1-yn-3-amine |
| SMILES | C#C/C(N)=C\C=C(C)C |
| InChI | InChI=1S/C8H11N/c1-4-8(9)6-5-7(2)3/h1,5-6H,9H2,2-3H3/b8-6+ |
| InChIKey | DFYUQEGMLSZHGP-SOFGYWHQSA-N |
| XLogP | 1.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|