About (3E)-6-methylhepta-3,5-dien-1-yn-3-amine
(3E)-6-methylhepta-3,5-dien-1-yn-3-amine (PubChem CID 167215613) has the molecular formula C8H11N
and a molecular weight of 121.18 g/mol. Its IUPAC name is (3E)-6-methylhepta-3,5-dien-1-yn-3-amine.
Molecular Properties
| Compound Name | (3E)-6-methylhepta-3,5-dien-1-yn-3-amine |
| PubChem CID | 167215613 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | (3E)-6-methylhepta-3,5-dien-1-yn-3-amine |
| SMILES | C#C/C(N)=C\C=C(C)C |
| InChI | InChI=1S/C8H11N/c1-4-8(9)6-5-7(2)3/h1,5-6H,9H2,2-3H3/b8-6+ |
| InChIKey | DFYUQEGMLSZHGP-SOFGYWHQSA-N |
| XLogP | 1.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3E)-6-methylhepta-3,5-dien-1-yn-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-6-methylhepta-3,5-dien-1-yn-3-amine?
The IUPAC name of (3E)-6-methylhepta-3,5-dien-1-yn-3-amine (CID 167215613) is (3E)-6-methylhepta-3,5-dien-1-yn-3-amine.
What is the SMILES notation for (3E)-6-methylhepta-3,5-dien-1-yn-3-amine?
The canonical SMILES for (3E)-6-methylhepta-3,5-dien-1-yn-3-amine is C#C/C(N)=C\C=C(C)C.
What is the InChIKey of (3E)-6-methylhepta-3,5-dien-1-yn-3-amine?
The InChIKey is DFYUQEGMLSZHGP-SOFGYWHQSA-N. The full InChI is InChI=1S/C8H11N/c1-4-8(9)6-5-7(2)3/h1,5-6H,9H2,2-3H3/b8-6+.
What are the key properties of (3E)-6-methylhepta-3,5-dien-1-yn-3-amine?
(3E)-6-methylhepta-3,5-dien-1-yn-3-amine has a molecular weight of 121.18 g/mol, XLogP of 1.43, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-6-methylhepta-3,5-dien-1-yn-3-amine is sourced from PubChem (CID 167215613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).