C17H16 — CID 142816570
1-[(3E)-3-ethynyl-6-methylhepta-3,5-dien-1-ynyl]-4-methylbenzene (PubChem CID 142816570) has the molecular formula C17H16 and a molecular weight of 220.31 g/mol. Its IUPAC name is 1-[(3E)-3-ethynyl-6-methylhepta-3,5-dien-1-ynyl]-4-methylbenzene.
| Compound Name | 1-[(3E)-3-ethynyl-6-methylhepta-3,5-dien-1-ynyl]-4-methylbenzene |
|---|---|
| PubChem CID | 142816570 |
| Molecular Formula | C17H16 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 1-[(3E)-3-ethynyl-6-methylhepta-3,5-dien-1-ynyl]-4-methylbenzene |
| SMILES | C#C/C(C#Cc1ccc(C)cc1)=C\C=C(C)C |
| InChI | InChI=1S/C17H16/c1-5-16(9-6-14(2)3)12-13-17-10-7-15(4)8-11-17/h1,6-11H,2-4H3/b16-9+ |
| InChIKey | XTGMYTUIEZWTDP-CXUHLZMHSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|