C21H25S+ — CID 58734613
[(2E)-5-methylhexa-2,4-dien-2-yl]-bis(4-methylphenyl)sulfanium (PubChem CID 58734613) has the molecular formula C21H25S+ and a molecular weight of 309.50 g/mol. Its IUPAC name is [(2E)-5-methylhexa-2,4-dien-2-yl]-bis(4-methylphenyl)sulfanium.
| Compound Name | [(2E)-5-methylhexa-2,4-dien-2-yl]-bis(4-methylphenyl)sulfanium |
|---|---|
| PubChem CID | 58734613 |
| Molecular Formula | C21H25S+ |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | [(2E)-5-methylhexa-2,4-dien-2-yl]-bis(4-methylphenyl)sulfanium |
| SMILES | CC(C)=C/C=C(\C)[S+](c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H25S/c1-16(2)6-11-19(5)22(20-12-7-17(3)8-13-20)21-14-9-18(4)10-15-21/h6-15H,1-5H3/q+1/b19-11+ |
| InChIKey | LQJBAHJLOVYOIK-YBFXNURJSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|