C29H41Cl3 — CID 143106639
bis(but-2-yne);1-chloro-4-methylbenzene;bis((2E)-2-chloro-5-methylhexa-2,4-diene) (PubChem CID 143106639) has the molecular formula C29H41Cl3 and a molecular weight of 496.01 g/mol. Its IUPAC name is bis(but-2-yne);1-chloro-4-methylbenzene;bis((2E)-2-chloro-5-methylhexa-2,4-diene).
| Compound Name | bis(but-2-yne);1-chloro-4-methylbenzene;bis((2E)-2-chloro-5-methylhexa-2,4-diene) |
|---|---|
| PubChem CID | 143106639 |
| Molecular Formula | C29H41Cl3 |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | bis(but-2-yne);1-chloro-4-methylbenzene;bis((2E)-2-chloro-5-methylhexa-2,4-diene) |
| SMILES | CC#CC.CC#CC.CC(C)=C/C=C(\C)Cl.CC(C)=C/C=C(\C)Cl.Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C7H7Cl.2C7H11Cl.2C4H6/c1-6-2-4-7(8)5-3-6;2*1-6(2)4-5-7(3)8;2*1-3-4-2/h2-5H,1H3;2*4-5H,1-3H3;2*1-2H3/b;2*7-5+;; |
| InChIKey | GHTFWAXMQLDLFP-YJBYQXNPSA-N |
| XLogP | 10.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|