C13H18 — CID 143338715
1-[(3Z,5Z)-hepta-3,5-dien-1-yn-3-yl]-2-propylcyclopropane (PubChem CID 143338715) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 1-[(3Z,5Z)-hepta-3,5-dien-1-yn-3-yl]-2-propylcyclopropane.
| Compound Name | 1-[(3Z,5Z)-hepta-3,5-dien-1-yn-3-yl]-2-propylcyclopropane |
|---|---|
| PubChem CID | 143338715 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 1-[(3Z,5Z)-hepta-3,5-dien-1-yn-3-yl]-2-propylcyclopropane |
| SMILES | C#C/C(=C\C=C/C)C1CC1CCC |
| InChI | InChI=1S/C13H18/c1-4-7-9-11(6-3)13-10-12(13)8-5-2/h3-4,7,9,12-13H,5,8,10H2,1-2H3/b7-4-,11-9+ |
| InChIKey | YELZROYLVXPCDN-RGSRAZRCSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|