C13H24O — CID 143524444
(5E,7Z)-5-methyl-4-propylnona-5,7-dien-4-ol (PubChem CID 143524444) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (5E,7Z)-5-methyl-4-propylnona-5,7-dien-4-ol.
| Compound Name | (5E,7Z)-5-methyl-4-propylnona-5,7-dien-4-ol |
|---|---|
| PubChem CID | 143524444 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (5E,7Z)-5-methyl-4-propylnona-5,7-dien-4-ol |
| SMILES | C/C=C\C=C(/C)C(O)(CCC)CCC |
| InChI | InChI=1S/C13H24O/c1-5-8-9-12(4)13(14,10-6-2)11-7-3/h5,8-9,14H,6-7,10-11H2,1-4H3/b8-5-,12-9+ |
| InChIKey | FKARUSWLOYABBZ-JWAJRPJHSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|