C10H21CeNO — CID 153491929
cerium;4-(C,N-dimethylcarbonimidoyl)heptan-4-ol (PubChem CID 153491929) has the molecular formula C10H21CeNO and a molecular weight of 311.40 g/mol. Its IUPAC name is cerium;4-(C,N-dimethylcarbonimidoyl)heptan-4-ol.
| Compound Name | cerium;4-(C,N-dimethylcarbonimidoyl)heptan-4-ol |
|---|---|
| PubChem CID | 153491929 |
| Molecular Formula | C10H21CeNO |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | cerium;4-(C,N-dimethylcarbonimidoyl)heptan-4-ol |
| SMILES | CCCC(O)(CCC)/C(C)=N/C.[Ce] |
| InChI | InChI=1S/C10H21NO.Ce/c1-5-7-10(12,8-6-2)9(3)11-4;/h12H,5-8H2,1-4H3;/b11-9+; |
| InChIKey | YPQYMGYKUDLQRQ-LBEJWNQZSA-N |
| XLogP | 2.41 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|