C10H21LuNO — CID 153491926
3-(C,N-dimethylcarbonimidoyl)-2-methylhexan-3-ol;lutetium (PubChem CID 153491926) has the molecular formula C10H21LuNO and a molecular weight of 346.25 g/mol. Its IUPAC name is 3-(C,N-dimethylcarbonimidoyl)-2-methylhexan-3-ol;lutetium.
| Compound Name | 3-(C,N-dimethylcarbonimidoyl)-2-methylhexan-3-ol;lutetium |
|---|---|
| PubChem CID | 153491926 |
| Molecular Formula | C10H21LuNO |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 3-(C,N-dimethylcarbonimidoyl)-2-methylhexan-3-ol;lutetium |
| SMILES | CCCC(O)(/C(C)=N/C)C(C)C.[Lu] |
| InChI | InChI=1S/C10H21NO.Lu/c1-6-7-10(12,8(2)3)9(4)11-5;/h8,12H,6-7H2,1-5H3;/b11-9+; |
| InChIKey | HKCMFJJKBCZJMS-LBEJWNQZSA-N |
| XLogP | 2.26 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|