About 3-ethyl-2-ethylimino-4-methylpentan-3-ol;lanthanum
3-ethyl-2-ethylimino-4-methylpentan-3-ol;lanthanum (PubChem CID 153491621) has the molecular formula C10H21LaNO
and a molecular weight of 310.19 g/mol. Its IUPAC name is 3-ethyl-2-ethylimino-4-methylpentan-3-ol;lanthanum.
Molecular Properties
| Compound Name | 3-ethyl-2-ethylimino-4-methylpentan-3-ol;lanthanum |
| PubChem CID | 153491621 |
| Molecular Formula | C10H21LaNO |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 3-ethyl-2-ethylimino-4-methylpentan-3-ol;lanthanum |
| SMILES | CC/N=C(\C)C(O)(CC)C(C)C.[La] |
| InChI | InChI=1S/C10H21NO.La/c1-6-10(12,8(3)4)9(5)11-7-2;/h8,12H,6-7H2,1-5H3;/b11-9+; |
| InChIKey | MDGRUNJBPKLFQW-LBEJWNQZSA-N |
| XLogP | 2.26 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2-ethylimino-4-methylpentan-3-ol;lanthanum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-ethylimino-4-methylpentan-3-ol;lanthanum?
The IUPAC name of 3-ethyl-2-ethylimino-4-methylpentan-3-ol;lanthanum (CID 153491621) is 3-ethyl-2-ethylimino-4-methylpentan-3-ol;lanthanum.
What is the SMILES notation for 3-ethyl-2-ethylimino-4-methylpentan-3-ol;lanthanum?
The canonical SMILES for 3-ethyl-2-ethylimino-4-methylpentan-3-ol;lanthanum is CC/N=C(\C)C(O)(CC)C(C)C.[La].
What is the InChIKey of 3-ethyl-2-ethylimino-4-methylpentan-3-ol;lanthanum?
The InChIKey is MDGRUNJBPKLFQW-LBEJWNQZSA-N. The full InChI is InChI=1S/C10H21NO.La/c1-6-10(12,8(3)4)9(5)11-7-2;/h8,12H,6-7H2,1-5H3;/b11-9+;.
What are the key properties of 3-ethyl-2-ethylimino-4-methylpentan-3-ol;lanthanum?
3-ethyl-2-ethylimino-4-methylpentan-3-ol;lanthanum has a molecular weight of 310.19 g/mol, XLogP of 2.26, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-ethylimino-4-methylpentan-3-ol;lanthanum is sourced from PubChem (CID 153491621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).