C9H19LaNO — CID 153491627
2-ethylimino-3-methylhexan-3-ol;lanthanum (PubChem CID 153491627) has the molecular formula C9H19LaNO and a molecular weight of 296.16 g/mol. Its IUPAC name is 2-ethylimino-3-methylhexan-3-ol;lanthanum.
| Compound Name | 2-ethylimino-3-methylhexan-3-ol;lanthanum |
|---|---|
| PubChem CID | 153491627 |
| Molecular Formula | C9H19LaNO |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 2-ethylimino-3-methylhexan-3-ol;lanthanum |
| SMILES | CCCC(C)(O)/C(C)=N/CC.[La] |
| InChI | InChI=1S/C9H19NO.La/c1-5-7-9(4,11)8(3)10-6-2;/h11H,5-7H2,1-4H3;/b10-8+; |
| InChIKey | BUAKUUZMANEJJO-VRTOBVRTSA-N |
| XLogP | 2.02 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|