About 4-(N-ethyl-C-methylcarbonimidoyl)heptan-4-ol;lanthanum
4-(N-ethyl-C-methylcarbonimidoyl)heptan-4-ol;lanthanum (PubChem CID 153491751) has the molecular formula C11H23LaNO
and a molecular weight of 324.22 g/mol. Its IUPAC name is 4-(N-ethyl-C-methylcarbonimidoyl)heptan-4-ol;lanthanum.
Molecular Properties
| Compound Name | 4-(N-ethyl-C-methylcarbonimidoyl)heptan-4-ol;lanthanum |
| PubChem CID | 153491751 |
| Molecular Formula | C11H23LaNO |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 4-(N-ethyl-C-methylcarbonimidoyl)heptan-4-ol;lanthanum |
| SMILES | CCCC(O)(CCC)/C(C)=N/CC.[La] |
| InChI | InChI=1S/C11H23NO.La/c1-5-8-11(13,9-6-2)10(4)12-7-3;/h13H,5-9H2,1-4H3;/b12-10+; |
| InChIKey | GCFAIXOLFOCMMQ-VHPXAQPISA-N |
| XLogP | 2.80 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(N-ethyl-C-methylcarbonimidoyl)heptan-4-ol;lanthanum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(N-ethyl-C-methylcarbonimidoyl)heptan-4-ol;lanthanum?
The IUPAC name of 4-(N-ethyl-C-methylcarbonimidoyl)heptan-4-ol;lanthanum (CID 153491751) is 4-(N-ethyl-C-methylcarbonimidoyl)heptan-4-ol;lanthanum.
What is the SMILES notation for 4-(N-ethyl-C-methylcarbonimidoyl)heptan-4-ol;lanthanum?
The canonical SMILES for 4-(N-ethyl-C-methylcarbonimidoyl)heptan-4-ol;lanthanum is CCCC(O)(CCC)/C(C)=N/CC.[La].
What is the InChIKey of 4-(N-ethyl-C-methylcarbonimidoyl)heptan-4-ol;lanthanum?
The InChIKey is GCFAIXOLFOCMMQ-VHPXAQPISA-N. The full InChI is InChI=1S/C11H23NO.La/c1-5-8-11(13,9-6-2)10(4)12-7-3;/h13H,5-9H2,1-4H3;/b12-10+;.
What are the key properties of 4-(N-ethyl-C-methylcarbonimidoyl)heptan-4-ol;lanthanum?
4-(N-ethyl-C-methylcarbonimidoyl)heptan-4-ol;lanthanum has a molecular weight of 324.22 g/mol, XLogP of 2.80, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(N-ethyl-C-methylcarbonimidoyl)heptan-4-ol;lanthanum is sourced from PubChem (CID 153491751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).