About 3-ethyl-2-ethyliminopentan-3-ol;europium
3-ethyl-2-ethyliminopentan-3-ol;europium (PubChem CID 153491784) has the molecular formula C9H19EuNO
and a molecular weight of 309.22 g/mol. Its IUPAC name is 3-ethyl-2-ethyliminopentan-3-ol;europium.
Molecular Properties
| Compound Name | 3-ethyl-2-ethyliminopentan-3-ol;europium |
| PubChem CID | 153491784 |
| Molecular Formula | C9H19EuNO |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 3-ethyl-2-ethyliminopentan-3-ol;europium |
| SMILES | CC/N=C(\C)C(O)(CC)CC.[Eu] |
| InChI | InChI=1S/C9H19NO.Eu/c1-5-9(11,6-2)8(4)10-7-3;/h11H,5-7H2,1-4H3;/b10-8+; |
| InChIKey | IDGIWZCZKQRJDP-VRTOBVRTSA-N |
| XLogP | 2.02 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2-ethyliminopentan-3-ol;europium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-ethyliminopentan-3-ol;europium?
The IUPAC name of 3-ethyl-2-ethyliminopentan-3-ol;europium (CID 153491784) is 3-ethyl-2-ethyliminopentan-3-ol;europium.
What is the SMILES notation for 3-ethyl-2-ethyliminopentan-3-ol;europium?
The canonical SMILES for 3-ethyl-2-ethyliminopentan-3-ol;europium is CC/N=C(\C)C(O)(CC)CC.[Eu].
What is the InChIKey of 3-ethyl-2-ethyliminopentan-3-ol;europium?
The InChIKey is IDGIWZCZKQRJDP-VRTOBVRTSA-N. The full InChI is InChI=1S/C9H19NO.Eu/c1-5-9(11,6-2)8(4)10-7-3;/h11H,5-7H2,1-4H3;/b10-8+;.
What are the key properties of 3-ethyl-2-ethyliminopentan-3-ol;europium?
3-ethyl-2-ethyliminopentan-3-ol;europium has a molecular weight of 309.22 g/mol, XLogP of 2.02, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-ethyliminopentan-3-ol;europium is sourced from PubChem (CID 153491784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).