C13H27NO — CID 153491819
N,3-diethyl-4-methyl-3-propoxypentan-2-imine (PubChem CID 153491819) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is N,3-diethyl-4-methyl-3-propoxypentan-2-imine.
| Compound Name | N,3-diethyl-4-methyl-3-propoxypentan-2-imine |
|---|---|
| PubChem CID | 153491819 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | N,3-diethyl-4-methyl-3-propoxypentan-2-imine |
| SMILES | CCCOC(CC)(/C(C)=N/CC)C(C)C |
| InChI | InChI=1S/C13H27NO/c1-7-10-15-13(8-2,11(4)5)12(6)14-9-3/h11H,7-10H2,1-6H3/b14-12+ |
| InChIKey | QJOMGPDRGNOEMI-WYMLVPIESA-N |
| XLogP | 3.70 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|