C11H23NOPm — CID 153491674
3-ethyl-2-methyl-4-propan-2-yliminopentan-3-ol;promethium (PubChem CID 153491674) has the molecular formula C11H23NOPm and a molecular weight of 330.31 g/mol. Its IUPAC name is 3-ethyl-2-methyl-4-propan-2-yliminopentan-3-ol;promethium.
| Compound Name | 3-ethyl-2-methyl-4-propan-2-yliminopentan-3-ol;promethium |
|---|---|
| PubChem CID | 153491674 |
| Molecular Formula | C11H23NOPm |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 3-ethyl-2-methyl-4-propan-2-yliminopentan-3-ol;promethium |
| SMILES | CCC(O)(/C(C)=N/C(C)C)C(C)C.[Pm] |
| InChI | InChI=1S/C11H23NO.Pm/c1-7-11(13,8(2)3)10(6)12-9(4)5;/h8-9,13H,7H2,1-6H3;/b12-10+; |
| InChIKey | VIULBRCGVYRMJL-VHPXAQPISA-N |
| XLogP | 2.65 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|