C11H23ErNO — CID 153491711
erbium;3-ethyl-2-propan-2-yliminohexan-3-ol (PubChem CID 153491711) has the molecular formula C11H23ErNO and a molecular weight of 352.57 g/mol. Its IUPAC name is erbium;3-ethyl-2-propan-2-yliminohexan-3-ol.
| Compound Name | erbium;3-ethyl-2-propan-2-yliminohexan-3-ol |
|---|---|
| PubChem CID | 153491711 |
| Molecular Formula | C11H23ErNO |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | erbium;3-ethyl-2-propan-2-yliminohexan-3-ol |
| SMILES | CCCC(O)(CC)/C(C)=N/C(C)C.[Er] |
| InChI | InChI=1S/C11H23NO.Er/c1-6-8-11(13,7-2)10(5)12-9(3)4;/h9,13H,6-8H2,1-5H3;/b12-10+; |
| InChIKey | KWBUOQVJUMOWQS-VHPXAQPISA-N |
| XLogP | 2.80 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|