C4H9N3 — CID 163586800
buta-1,3-diene-1,2,4-triamine (PubChem CID 163586800) has the molecular formula C4H9N3 and a molecular weight of 99.14 g/mol. Its IUPAC name is buta-1,3-diene-1,2,4-triamine.
| Compound Name | buta-1,3-diene-1,2,4-triamine |
|---|---|
| PubChem CID | 163586800 |
| Molecular Formula | C4H9N3 |
| Molecular Weight | 99.14 g/mol |
| Exact Mass | 99.08 |
| IUPAC Name | buta-1,3-diene-1,2,4-triamine |
| SMILES | NC=CC(N)=CN |
| InChI | InChI=1S/C4H9N3/c5-2-1-4(7)3-6/h1-3H,5-7H2 |
| InChIKey | GMDRVGGNJWRMBX-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.14 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|