C4H10N3+ — CID 149116825
2,3-diaminoprop-2-enylidene(methyl)azanium (PubChem CID 149116825) has the molecular formula C4H10N3+ and a molecular weight of 100.14 g/mol. Its IUPAC name is 2,3-diaminoprop-2-enylidene(methyl)azanium.
| Compound Name | 2,3-diaminoprop-2-enylidene(methyl)azanium |
|---|---|
| PubChem CID | 149116825 |
| Molecular Formula | C4H10N3+ |
| Molecular Weight | 100.14 g/mol |
| Exact Mass | 100.09 |
| IUPAC Name | 2,3-diaminoprop-2-enylidene(methyl)azanium |
| SMILES | C/[NH+]=C/C(N)=CN |
| InChI | InChI=1S/C4H9N3/c1-7-3-4(6)2-5/h2-3H,5-6H2,1H3/p+1/b4-2?,7-3+ |
| InChIKey | QCSOQIDNIVAQTC-WHZWGVERSA-O |
| XLogP | -2.47 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.14 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|