C5H12N2O — CID 145148062
(Z)-4,5-diaminopent-4-en-1-ol (PubChem CID 145148062) has the molecular formula C5H12N2O and a molecular weight of 116.16 g/mol. Its IUPAC name is (Z)-4,5-diaminopent-4-en-1-ol.
| Compound Name | (Z)-4,5-diaminopent-4-en-1-ol |
|---|---|
| PubChem CID | 145148062 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | (Z)-4,5-diaminopent-4-en-1-ol |
| SMILES | N/C=C(\N)CCCO |
| InChI | InChI=1S/C5H12N2O/c6-4-5(7)2-1-3-8/h4,8H,1-3,6-7H2/b5-4- |
| InChIKey | DPOPWHHBBPFDJG-PLNGDYQASA-N |
| XLogP | -0.48 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |