About 6-aminooct-5-en-1-ol;azane
6-aminooct-5-en-1-ol;azane (PubChem CID 173397334) has the molecular formula C8H20N2O
and a molecular weight of 160.26 g/mol. Its IUPAC name is 6-aminooct-5-en-1-ol;azane.
Molecular Properties
| Compound Name | 6-aminooct-5-en-1-ol;azane |
| PubChem CID | 173397334 |
| Molecular Formula | C8H20N2O |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | 6-aminooct-5-en-1-ol;azane |
| SMILES | CCC(N)=CCCCCO.N |
| InChI | InChI=1S/C8H17NO.H3N/c1-2-8(9)6-4-3-5-7-10;/h6,10H,2-5,7,9H2,1H3;1H3 |
| InChIKey | KRUNHSFERQQEJT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-aminooct-5-en-1-ol;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-aminooct-5-en-1-ol;azane?
The IUPAC name of 6-aminooct-5-en-1-ol;azane (CID 173397334) is 6-aminooct-5-en-1-ol;azane.
What is the SMILES notation for 6-aminooct-5-en-1-ol;azane?
The canonical SMILES for 6-aminooct-5-en-1-ol;azane is CCC(N)=CCCCCO.N.
What is the InChIKey of 6-aminooct-5-en-1-ol;azane?
The InChIKey is KRUNHSFERQQEJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.H3N/c1-2-8(9)6-4-3-5-7-10;/h6,10H,2-5,7,9H2,1H3;1H3.
What are the key properties of 6-aminooct-5-en-1-ol;azane?
6-aminooct-5-en-1-ol;azane has a molecular weight of 160.26 g/mol, XLogP of 1.56, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-aminooct-5-en-1-ol;azane is sourced from PubChem (CID 173397334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).