C7H11N3 — CID 169172650
(E)-3-but-3-yn-2-yliminoprop-1-ene-1,2-diamine (PubChem CID 169172650) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is (E)-3-but-3-yn-2-yliminoprop-1-ene-1,2-diamine.
| Compound Name | (E)-3-but-3-yn-2-yliminoprop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 169172650 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | (E)-3-but-3-yn-2-yliminoprop-1-ene-1,2-diamine |
| SMILES | C#CC(C)/N=C/C(N)=C\N |
| InChI | InChI=1S/C7H11N3/c1-3-6(2)10-5-7(9)4-8/h1,4-6H,8-9H2,2H3/b7-4+,10-5+ |
| InChIKey | NULBJBNCKLUPML-HOZCHFDZSA-N |
| XLogP | -0.16 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|