C8H19F2N3 — CID 176699628
(Z)-1-[amino(propan-2-yl)amino]-3,3-difluoroprop-1-en-2-amine;ethane (PubChem CID 176699628) has the molecular formula C8H19F2N3 and a molecular weight of 195.26 g/mol. Its IUPAC name is (Z)-1-[amino(propan-2-yl)amino]-3,3-difluoroprop-1-en-2-amine;ethane.
| Compound Name | (Z)-1-[amino(propan-2-yl)amino]-3,3-difluoroprop-1-en-2-amine;ethane |
|---|---|
| PubChem CID | 176699628 |
| Molecular Formula | C8H19F2N3 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | (Z)-1-[amino(propan-2-yl)amino]-3,3-difluoroprop-1-en-2-amine;ethane |
| SMILES | CC.CC(C)N(N)/C=C(\N)C(F)F |
| InChI | InChI=1S/C6H13F2N3.C2H6/c1-4(2)11(10)3-5(9)6(7)8;1-2/h3-4,6H,9-10H2,1-2H3;1-2H3/b5-3-; |
| InChIKey | DVZKVFLXWOBUHM-FBZPGIPVSA-N |
| XLogP | 1.66 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|