C6H13F2N3 — CID 156637586
(Z)-1-[amino(propan-2-yl)amino]-3,3-difluoroprop-1-en-2-amine (PubChem CID 156637586) has the molecular formula C6H13F2N3 and a molecular weight of 165.19 g/mol. Its IUPAC name is (Z)-1-[amino(propan-2-yl)amino]-3,3-difluoroprop-1-en-2-amine.
| Compound Name | (Z)-1-[amino(propan-2-yl)amino]-3,3-difluoroprop-1-en-2-amine |
|---|---|
| PubChem CID | 156637586 |
| Molecular Formula | C6H13F2N3 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.11 |
| IUPAC Name | (Z)-1-[amino(propan-2-yl)amino]-3,3-difluoroprop-1-en-2-amine |
| SMILES | CC(C)N(N)/C=C(\N)C(F)F |
| InChI | InChI=1S/C6H13F2N3/c1-4(2)11(10)3-5(9)6(7)8/h3-4,6H,9-10H2,1-2H3/b5-3- |
| InChIKey | GLQGMTJAKKSPSY-HYXAFXHYSA-N |
| XLogP | 0.64 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|