C10H21N3 — CID 146213851
N-[(Z)-1-[amino(propan-2-yl)amino]-3,3-dimethylbut-1-en-2-yl]methanimine (PubChem CID 146213851) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is N-[(Z)-1-[amino(propan-2-yl)amino]-3,3-dimethylbut-1-en-2-yl]methanimine.
| Compound Name | N-[(Z)-1-[amino(propan-2-yl)amino]-3,3-dimethylbut-1-en-2-yl]methanimine |
|---|---|
| PubChem CID | 146213851 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | N-[(Z)-1-[amino(propan-2-yl)amino]-3,3-dimethylbut-1-en-2-yl]methanimine |
| SMILES | C=N/C(=C\N(N)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C10H21N3/c1-8(2)13(11)7-9(12-6)10(3,4)5/h7-8H,6,11H2,1-5H3/b9-7- |
| InChIKey | GLPGAMNNMVIOFN-CLFYSBASSA-N |
| XLogP | 2.16 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|