C9H21N3O — CID 178050350
(Z)-1-[amino(propan-2-yl)amino]-3-propan-2-yloxyprop-1-en-2-amine (PubChem CID 178050350) has the molecular formula C9H21N3O and a molecular weight of 187.29 g/mol. Its IUPAC name is (Z)-1-[amino(propan-2-yl)amino]-3-propan-2-yloxyprop-1-en-2-amine.
| Compound Name | (Z)-1-[amino(propan-2-yl)amino]-3-propan-2-yloxyprop-1-en-2-amine |
|---|---|
| PubChem CID | 178050350 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | (Z)-1-[amino(propan-2-yl)amino]-3-propan-2-yloxyprop-1-en-2-amine |
| SMILES | CC(C)OC/C(N)=C/N(N)C(C)C |
| InChI | InChI=1S/C9H21N3O/c1-7(2)12(11)5-9(10)6-13-8(3)4/h5,7-8H,6,10-11H2,1-4H3/b9-5- |
| InChIKey | NVOGARHJDYVTHH-UITAMQMPSA-N |
| XLogP | 0.80 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|