C15H33N3O3 — CID 145160419
(Z)-1-[amino(2-prop-2-enoxyethyl)amino]-3-methoxyprop-1-en-2-amine;methoxyethane;prop-1-ene (PubChem CID 145160419) has the molecular formula C15H33N3O3 and a molecular weight of 303.45 g/mol. Its IUPAC name is (Z)-1-[amino(2-prop-2-enoxyethyl)amino]-3-methoxyprop-1-en-2-amine;methoxyethane;prop-1-ene.
| Compound Name | (Z)-1-[amino(2-prop-2-enoxyethyl)amino]-3-methoxyprop-1-en-2-amine;methoxyethane;prop-1-ene |
|---|---|
| PubChem CID | 145160419 |
| Molecular Formula | C15H33N3O3 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.25 |
| IUPAC Name | (Z)-1-[amino(2-prop-2-enoxyethyl)amino]-3-methoxyprop-1-en-2-amine;methoxyethane;prop-1-ene |
| SMILES | C=CC.C=CCOCCN(N)/C=C(\N)COC.CCOC |
| InChI | InChI=1S/C9H19N3O2.C3H8O.C3H6/c1-3-5-14-6-4-12(11)7-9(10)8-13-2;1-3-4-2;1-3-2/h3,7H,1,4-6,8,10-11H2,2H3;3H2,1-2H3;3H,1H2,2H3/b9-7-;; |
| InChIKey | XNZKFLCJEZSALU-COUYFGMESA-N |
| XLogP | 1.66 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|