C7H17N3O2 — CID 144584894
2-[amino-[(Z)-2-amino-3-ethoxyprop-1-enyl]amino]ethanol (PubChem CID 144584894) has the molecular formula C7H17N3O2 and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-[amino-[(Z)-2-amino-3-ethoxyprop-1-enyl]amino]ethanol.
| Compound Name | 2-[amino-[(Z)-2-amino-3-ethoxyprop-1-enyl]amino]ethanol |
|---|---|
| PubChem CID | 144584894 |
| Molecular Formula | C7H17N3O2 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.13 |
| IUPAC Name | 2-[amino-[(Z)-2-amino-3-ethoxyprop-1-enyl]amino]ethanol |
| SMILES | CCOC/C(N)=C/N(N)CCO |
| InChI | InChI=1S/C7H17N3O2/c1-2-12-6-7(8)5-10(9)3-4-11/h5,11H,2-4,6,8-9H2,1H3/b7-5- |
| InChIKey | GLSFTRIRLHNDIS-ALCCZGGFSA-N |
| XLogP | -1.01 |
| TPSA | 84.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|