C9H21N3O2 — CID 167461865
(Z)-1-[amino(2-methoxyethyl)amino]-3-propan-2-yloxyprop-1-en-2-amine (PubChem CID 167461865) has the molecular formula C9H21N3O2 and a molecular weight of 203.29 g/mol. Its IUPAC name is (Z)-1-[amino(2-methoxyethyl)amino]-3-propan-2-yloxyprop-1-en-2-amine.
| Compound Name | (Z)-1-[amino(2-methoxyethyl)amino]-3-propan-2-yloxyprop-1-en-2-amine |
|---|---|
| PubChem CID | 167461865 |
| Molecular Formula | C9H21N3O2 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.16 |
| IUPAC Name | (Z)-1-[amino(2-methoxyethyl)amino]-3-propan-2-yloxyprop-1-en-2-amine |
| SMILES | COCCN(N)/C=C(\N)COC(C)C |
| InChI | InChI=1S/C9H21N3O2/c1-8(2)14-7-9(10)6-12(11)4-5-13-3/h6,8H,4-5,7,10-11H2,1-3H3/b9-6- |
| InChIKey | NVAHGHJXOKVLLN-TWGQIWQCSA-N |
| XLogP | 0.03 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|