About 3-ethyl-5-(propan-2-yloxymethyl)-1,2-dihydrotriazole
3-ethyl-5-(propan-2-yloxymethyl)-1,2-dihydrotriazole (PubChem CID 142397408) has the molecular formula C8H17N3O
and a molecular weight of 171.24 g/mol. Its IUPAC name is 3-ethyl-5-(propan-2-yloxymethyl)-1,2-dihydrotriazole.
Analyze 3-ethyl-5-(propan-2-yloxymethyl)-1,2-dihydrotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-(propan-2-yloxymethyl)-1,2-dihydrotriazole?
The IUPAC name of 3-ethyl-5-(propan-2-yloxymethyl)-1,2-dihydrotriazole (CID 142397408) is 3-ethyl-5-(propan-2-yloxymethyl)-1,2-dihydrotriazole.
What is the SMILES notation for 3-ethyl-5-(propan-2-yloxymethyl)-1,2-dihydrotriazole?
The canonical SMILES for 3-ethyl-5-(propan-2-yloxymethyl)-1,2-dihydrotriazole is CCN1C=C(COC(C)C)NN1.
What is the InChIKey of 3-ethyl-5-(propan-2-yloxymethyl)-1,2-dihydrotriazole?
The InChIKey is VRVHESONHHTCQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O/c1-4-11-5-8(9-10-11)6-12-7(2)3/h5,7,9-10H,4,6H2,1-3H3.
What are the key properties of 3-ethyl-5-(propan-2-yloxymethyl)-1,2-dihydrotriazole?
3-ethyl-5-(propan-2-yloxymethyl)-1,2-dihydrotriazole has a molecular weight of 171.24 g/mol, XLogP of 0.60, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-(propan-2-yloxymethyl)-1,2-dihydrotriazole is sourced from PubChem (CID 142397408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).