C9H21N3O3 — CID 164602472
(Z)-2-hydrazinyl-3-[2-(2-methoxyethoxy)ethoxy]-N-methylprop-1-en-1-amine (PubChem CID 164602472) has the molecular formula C9H21N3O3 and a molecular weight of 219.28 g/mol. Its IUPAC name is (Z)-2-hydrazinyl-3-[2-(2-methoxyethoxy)ethoxy]-N-methylprop-1-en-1-amine.
| Compound Name | (Z)-2-hydrazinyl-3-[2-(2-methoxyethoxy)ethoxy]-N-methylprop-1-en-1-amine |
|---|---|
| PubChem CID | 164602472 |
| Molecular Formula | C9H21N3O3 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (Z)-2-hydrazinyl-3-[2-(2-methoxyethoxy)ethoxy]-N-methylprop-1-en-1-amine |
| SMILES | CN/C=C(/COCCOCCOC)NN |
| InChI | InChI=1S/C9H21N3O3/c1-11-7-9(12-10)8-15-6-5-14-4-3-13-2/h7,11-12H,3-6,8,10H2,1-2H3/b9-7- |
| InChIKey | FLUPNWCNVRNJDL-CLFYSBASSA-N |
| XLogP | -0.81 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|