C9H19N3O2 — CID 145229984
2-hydrazinyl-N-[2-(2-methoxyethoxy)ethyl]buta-1,3-dien-1-amine (PubChem CID 145229984) has the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-hydrazinyl-N-[2-(2-methoxyethoxy)ethyl]buta-1,3-dien-1-amine.
| Compound Name | 2-hydrazinyl-N-[2-(2-methoxyethoxy)ethyl]buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 145229984 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-hydrazinyl-N-[2-(2-methoxyethoxy)ethyl]buta-1,3-dien-1-amine |
| SMILES | C=CC(=CNCCOCCOC)NN |
| InChI | InChI=1S/C9H19N3O2/c1-3-9(12-10)8-11-4-5-14-7-6-13-2/h3,8,11-12H,1,4-7,10H2,2H3 |
| InChIKey | CNBRAULAASVKQP-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|