C11H27N3O2 — CID 167461864
(Z)-1-[amino(2-methoxyethyl)amino]-3-propan-2-yloxyprop-1-en-2-amine;ethane (PubChem CID 167461864) has the molecular formula C11H27N3O2 and a molecular weight of 233.36 g/mol. Its IUPAC name is (Z)-1-[amino(2-methoxyethyl)amino]-3-propan-2-yloxyprop-1-en-2-amine;ethane.
| Compound Name | (Z)-1-[amino(2-methoxyethyl)amino]-3-propan-2-yloxyprop-1-en-2-amine;ethane |
|---|---|
| PubChem CID | 167461864 |
| Molecular Formula | C11H27N3O2 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | (Z)-1-[amino(2-methoxyethyl)amino]-3-propan-2-yloxyprop-1-en-2-amine;ethane |
| SMILES | CC.COCCN(N)/C=C(\N)COC(C)C |
| InChI | InChI=1S/C9H21N3O2.C2H6/c1-8(2)14-7-9(10)6-12(11)4-5-13-3;1-2/h6,8H,4-5,7,10-11H2,1-3H3;1-2H3/b9-6-; |
| InChIKey | REULATSWROXKQX-BORNJIKYSA-N |
| XLogP | 1.06 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|