About (3Z)-3-(aminomethylidene)-6-methyl-1,4-oxazin-4-amine
(3Z)-3-(aminomethylidene)-6-methyl-1,4-oxazin-4-amine (PubChem CID 144931672) has the molecular formula C6H11N3O
and a molecular weight of 141.17 g/mol. Its IUPAC name is (3Z)-3-(aminomethylidene)-6-methyl-1,4-oxazin-4-amine.
Molecular Properties
| Compound Name | (3Z)-3-(aminomethylidene)-6-methyl-1,4-oxazin-4-amine |
| PubChem CID | 144931672 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | (3Z)-3-(aminomethylidene)-6-methyl-1,4-oxazin-4-amine |
| SMILES | CC1=CN(N)/C(=C\N)CO1 |
| InChI | InChI=1S/C6H11N3O/c1-5-3-9(8)6(2-7)4-10-5/h2-3H,4,7-8H2,1H3/b6-2- |
| InChIKey | PBXBWBAHRJXAKZ-KXFIGUGUSA-N |
| XLogP | -0.15 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-(aminomethylidene)-6-methyl-1,4-oxazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-(aminomethylidene)-6-methyl-1,4-oxazin-4-amine?
The IUPAC name of (3Z)-3-(aminomethylidene)-6-methyl-1,4-oxazin-4-amine (CID 144931672) is (3Z)-3-(aminomethylidene)-6-methyl-1,4-oxazin-4-amine.
What is the SMILES notation for (3Z)-3-(aminomethylidene)-6-methyl-1,4-oxazin-4-amine?
The canonical SMILES for (3Z)-3-(aminomethylidene)-6-methyl-1,4-oxazin-4-amine is CC1=CN(N)/C(=C\N)CO1.
What is the InChIKey of (3Z)-3-(aminomethylidene)-6-methyl-1,4-oxazin-4-amine?
The InChIKey is PBXBWBAHRJXAKZ-KXFIGUGUSA-N. The full InChI is InChI=1S/C6H11N3O/c1-5-3-9(8)6(2-7)4-10-5/h2-3H,4,7-8H2,1H3/b6-2-.
What are the key properties of (3Z)-3-(aminomethylidene)-6-methyl-1,4-oxazin-4-amine?
(3Z)-3-(aminomethylidene)-6-methyl-1,4-oxazin-4-amine has a molecular weight of 141.17 g/mol, XLogP of -0.15, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-(aminomethylidene)-6-methyl-1,4-oxazin-4-amine is sourced from PubChem (CID 144931672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).