C9H23N3O2 — CID 144584893
2-[amino-[(Z)-2-amino-3-ethoxyprop-1-enyl]amino]ethanol;ethane (PubChem CID 144584893) has the molecular formula C9H23N3O2 and a molecular weight of 205.30 g/mol. Its IUPAC name is 2-[amino-[(Z)-2-amino-3-ethoxyprop-1-enyl]amino]ethanol;ethane.
| Compound Name | 2-[amino-[(Z)-2-amino-3-ethoxyprop-1-enyl]amino]ethanol;ethane |
|---|---|
| PubChem CID | 144584893 |
| Molecular Formula | C9H23N3O2 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 2-[amino-[(Z)-2-amino-3-ethoxyprop-1-enyl]amino]ethanol;ethane |
| SMILES | CC.CCOC/C(N)=C/N(N)CCO |
| InChI | InChI=1S/C7H17N3O2.C2H6/c1-2-12-6-7(8)5-10(9)3-4-11;1-2/h5,11H,2-4,6,8-9H2,1H3;1-2H3/b7-5-; |
| InChIKey | DGIDCZTUOLNMLB-YJOCEBFMSA-N |
| XLogP | 0.02 |
| TPSA | 84.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|