C22H45N5O8 — CID 172595597
2-[amino-[(Z)-2-amino-3-[2-[2-[2-[2-[3-(3-methylbutylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]prop-1-enyl]amino]ethylcarbamic acid (PubChem CID 172595597) has the molecular formula C22H45N5O8 and a molecular weight of 507.63 g/mol. Its IUPAC name is 2-[amino-[(Z)-2-amino-3-[2-[2-[2-[2-[3-(3-methylbutylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]prop-1-enyl]amino]ethylcarbamic acid.
| Compound Name | 2-[amino-[(Z)-2-amino-3-[2-[2-[2-[2-[3-(3-methylbutylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]prop-1-enyl]amino]ethylcarbamic acid |
|---|---|
| PubChem CID | 172595597 |
| Molecular Formula | C22H45N5O8 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.33 |
| IUPAC Name | 2-[amino-[(Z)-2-amino-3-[2-[2-[2-[2-[3-(3-methylbutylamino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]prop-1-enyl]amino]ethylcarbamic acid |
| SMILES | CC(C)CCNC(=O)CCOCCOCCOCCOCCOC/C(N)=C/N(N)CCNC(=O)O |
| InChI | InChI=1S/C22H45N5O8/c1-19(2)3-5-25-21(28)4-8-31-9-10-32-11-12-33-13-14-34-15-16-35-18-20(23)17-27(24)7-6-26-22(29)30/h17,19,26H,3-16,18,23-24H2,1-2H3,(H,25,28)(H,29,30)/b20-17- |
| InChIKey | NTOMJGGVLAKNAK-JZJYNLBNSA-N |
| XLogP | -0.13 |
| TPSA | 179.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|