C21H36N4O6 — CID 166479274
3-[2-[2-[amino-[(Z)-2-amino-3-(2-propoxyethoxy)prop-1-enyl]amino]ethoxy]ethoxy]-N-(4-hydroxyphenyl)propanamide (PubChem CID 166479274) has the molecular formula C21H36N4O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is 3-[2-[2-[amino-[(Z)-2-amino-3-(2-propoxyethoxy)prop-1-enyl]amino]ethoxy]ethoxy]-N-(4-hydroxyphenyl)propanamide.
| Compound Name | 3-[2-[2-[amino-[(Z)-2-amino-3-(2-propoxyethoxy)prop-1-enyl]amino]ethoxy]ethoxy]-N-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 166479274 |
| Molecular Formula | C21H36N4O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 3-[2-[2-[amino-[(Z)-2-amino-3-(2-propoxyethoxy)prop-1-enyl]amino]ethoxy]ethoxy]-N-(4-hydroxyphenyl)propanamide |
| SMILES | CCCOCCOC/C(N)=C/N(N)CCOCCOCCC(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C21H36N4O6/c1-2-9-28-14-15-31-17-18(22)16-25(23)8-11-30-13-12-29-10-7-21(27)24-19-3-5-20(26)6-4-19/h3-6,16,26H,2,7-15,17,22-23H2,1H3,(H,24,27)/b18-16- |
| InChIKey | YGMRNWVQSKMVEL-VLGSPTGOSA-N |
| XLogP | 1.17 |
| TPSA | 141.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|