About (Z)-1-[amino(3-methoxypropyl)amino]-3-methoxyprop-1-en-2-amine;ethane
(Z)-1-[amino(3-methoxypropyl)amino]-3-methoxyprop-1-en-2-amine;ethane (PubChem CID 164586106) has the molecular formula C10H25N3O2
and a molecular weight of 219.33 g/mol. Its IUPAC name is (Z)-1-[amino(3-methoxypropyl)amino]-3-methoxyprop-1-en-2-amine;ethane.
Molecular Properties
| Compound Name | (Z)-1-[amino(3-methoxypropyl)amino]-3-methoxyprop-1-en-2-amine;ethane |
| PubChem CID | 164586106 |
| Molecular Formula | C10H25N3O2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.19 |
| IUPAC Name | (Z)-1-[amino(3-methoxypropyl)amino]-3-methoxyprop-1-en-2-amine;ethane |
| SMILES | CC.COCCCN(N)/C=C(\N)COC |
| InChI | InChI=1S/C8H19N3O2.C2H6/c1-12-5-3-4-11(10)6-8(9)7-13-2;1-2/h6H,3-5,7,9-10H2,1-2H3;1-2H3/b8-6-; |
| InChIKey | CYRIQDKENIPPJX-PHZXCRFESA-N |
| XLogP | 0.67 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-[amino(3-methoxypropyl)amino]-3-methoxyprop-1-en-2-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-[amino(3-methoxypropyl)amino]-3-methoxyprop-1-en-2-amine;ethane?
The IUPAC name of (Z)-1-[amino(3-methoxypropyl)amino]-3-methoxyprop-1-en-2-amine;ethane (CID 164586106) is (Z)-1-[amino(3-methoxypropyl)amino]-3-methoxyprop-1-en-2-amine;ethane.
What is the SMILES notation for (Z)-1-[amino(3-methoxypropyl)amino]-3-methoxyprop-1-en-2-amine;ethane?
The canonical SMILES for (Z)-1-[amino(3-methoxypropyl)amino]-3-methoxyprop-1-en-2-amine;ethane is CC.COCCCN(N)/C=C(\N)COC.
What is the InChIKey of (Z)-1-[amino(3-methoxypropyl)amino]-3-methoxyprop-1-en-2-amine;ethane?
The InChIKey is CYRIQDKENIPPJX-PHZXCRFESA-N. The full InChI is InChI=1S/C8H19N3O2.C2H6/c1-12-5-3-4-11(10)6-8(9)7-13-2;1-2/h6H,3-5,7,9-10H2,1-2H3;1-2H3/b8-6-;.
What are the key properties of (Z)-1-[amino(3-methoxypropyl)amino]-3-methoxyprop-1-en-2-amine;ethane?
(Z)-1-[amino(3-methoxypropyl)amino]-3-methoxyprop-1-en-2-amine;ethane has a molecular weight of 219.33 g/mol, XLogP of 0.67, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-[amino(3-methoxypropyl)amino]-3-methoxyprop-1-en-2-amine;ethane is sourced from PubChem (CID 164586106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).