C15H37N3O4 — CID 145396356
(Z)-2-amino-3-[amino-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]amino]prop-2-en-1-ol;ethane (PubChem CID 145396356) has the molecular formula C15H37N3O4 and a molecular weight of 323.48 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]amino]prop-2-en-1-ol;ethane.
| Compound Name | (Z)-2-amino-3-[amino-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]amino]prop-2-en-1-ol;ethane |
|---|---|
| PubChem CID | 145396356 |
| Molecular Formula | C15H37N3O4 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.28 |
| IUPAC Name | (Z)-2-amino-3-[amino-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]amino]prop-2-en-1-ol;ethane |
| SMILES | CC.CC.CCOCCOCCOCCN(N)/C=C(\N)CO |
| InChI | InChI=1S/C11H25N3O4.2C2H6/c1-2-16-5-6-18-8-7-17-4-3-14(13)9-11(12)10-15;2*1-2/h9,15H,2-8,10,12-13H2,1H3;2*1-2H3/b11-9-;; |
| InChIKey | UEOXJSLMJIBCIJ-WSELPHFCSA-N |
| XLogP | 1.08 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|