C31H69N3O12 — CID 145396383
(Z)-2-amino-3-[amino-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]amino]prop-2-en-1-ol;ethane (PubChem CID 145396383) has the molecular formula C31H69N3O12 and a molecular weight of 675.90 g/mol. Its IUPAC name is (Z)-2-amino-3-[amino-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]amino]prop-2-en-1-ol;ethane.
| Compound Name | (Z)-2-amino-3-[amino-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]amino]prop-2-en-1-ol;ethane |
|---|---|
| PubChem CID | 145396383 |
| Molecular Formula | C31H69N3O12 |
| Molecular Weight | 675.90 g/mol |
| Exact Mass | 675.49 |
| IUPAC Name | (Z)-2-amino-3-[amino-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]amino]prop-2-en-1-ol;ethane |
| SMILES | CC.CC.CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN(N)/C=C(\N)CO |
| InChI | InChI=1S/C27H57N3O12.2C2H6/c1-2-32-5-6-34-9-10-36-13-14-38-17-18-40-21-22-42-24-23-41-20-19-39-16-15-37-12-11-35-8-7-33-4-3-30(29)25-27(28)26-31;2*1-2/h25,31H,2-24,26,28-29H2,1H3;2*1-2H3/b27-25-;; |
| InChIKey | VKJHXQODEUXSQR-XONOVKDISA-N |
| XLogP | 1.21 |
| TPSA | 177.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.90 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|