C12H18ClF2N3 — CID 144897744
(Z)-1-(N-amino-4-chloro-2-methylanilino)-3,3-difluoroprop-1-en-2-amine;ethane (PubChem CID 144897744) has the molecular formula C12H18ClF2N3 and a molecular weight of 277.75 g/mol. Its IUPAC name is (Z)-1-(N-amino-4-chloro-2-methylanilino)-3,3-difluoroprop-1-en-2-amine;ethane.
| Compound Name | (Z)-1-(N-amino-4-chloro-2-methylanilino)-3,3-difluoroprop-1-en-2-amine;ethane |
|---|---|
| PubChem CID | 144897744 |
| Molecular Formula | C12H18ClF2N3 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (Z)-1-(N-amino-4-chloro-2-methylanilino)-3,3-difluoroprop-1-en-2-amine;ethane |
| SMILES | CC.Cc1cc(Cl)ccc1N(N)/C=C(\N)C(F)F |
| InChI | InChI=1S/C10H12ClF2N3.C2H6/c1-6-4-7(11)2-3-9(6)16(15)5-8(14)10(12)13;1-2/h2-5,10H,14-15H2,1H3;1-2H3/b8-5-; |
| InChIKey | UZBNRIOXDJGCCY-HGKIGUAWSA-N |
| XLogP | 3.42 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|