C11H18ClN — CID 143418789
4-chloro-N,N,2-trimethylaniline;ethane (PubChem CID 143418789) has the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. Its IUPAC name is 4-chloro-N,N,2-trimethylaniline;ethane.
| Compound Name | 4-chloro-N,N,2-trimethylaniline;ethane |
|---|---|
| PubChem CID | 143418789 |
| Molecular Formula | C11H18ClN |
| Molecular Weight | 199.72 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 4-chloro-N,N,2-trimethylaniline;ethane |
| SMILES | CC.Cc1cc(Cl)ccc1N(C)C |
| InChI | InChI=1S/C9H12ClN.C2H6/c1-7-6-8(10)4-5-9(7)11(2)3;1-2/h4-6H,1-3H3;1-2H3 |
| InChIKey | ZBBRUBYCADGLCM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.72 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |