C11H18N2 — CID 18543495
4-(2-aminoethyl)-N,N,2-trimethylaniline (PubChem CID 18543495) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N,N,2-trimethylaniline.
| Compound Name | 4-(2-aminoethyl)-N,N,2-trimethylaniline |
|---|---|
| PubChem CID | 18543495 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 4-(2-aminoethyl)-N,N,2-trimethylaniline |
| SMILES | Cc1cc(CCN)ccc1N(C)C |
| InChI | InChI=1S/C11H18N2/c1-9-8-10(6-7-12)4-5-11(9)13(2)3/h4-5,8H,6-7,12H2,1-3H3 |
| InChIKey | XROJZLIRJNNLMR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |