C16H26N2 — CID 107402420
4-(2-aminoethyl)-N-(cyclobutylmethyl)-N-ethyl-2-methylaniline (PubChem CID 107402420) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N-(cyclobutylmethyl)-N-ethyl-2-methylaniline.
| Compound Name | 4-(2-aminoethyl)-N-(cyclobutylmethyl)-N-ethyl-2-methylaniline |
|---|---|
| PubChem CID | 107402420 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 4-(2-aminoethyl)-N-(cyclobutylmethyl)-N-ethyl-2-methylaniline |
| SMILES | CCN(CC1CCC1)c1ccc(CCN)cc1C |
| InChI | InChI=1S/C16H26N2/c1-3-18(12-15-5-4-6-15)16-8-7-14(9-10-17)11-13(16)2/h7-8,11,15H,3-6,9-10,12,17H2,1-2H3 |
| InChIKey | WPLUNLGLZUNHFT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |