C10H14ClN — CID 11959023
5-chloro-N,N,2,4-tetramethylaniline (PubChem CID 11959023) has the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. Its IUPAC name is 5-chloro-N,N,2,4-tetramethylaniline.
| Compound Name | 5-chloro-N,N,2,4-tetramethylaniline |
|---|---|
| PubChem CID | 11959023 |
| Molecular Formula | C10H14ClN |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 5-chloro-N,N,2,4-tetramethylaniline |
| SMILES | Cc1cc(C)c(N(C)C)cc1Cl |
| InChI | InChI=1S/C10H14ClN/c1-7-5-8(2)10(12(3)4)6-9(7)11/h5-6H,1-4H3 |
| InChIKey | BTYLNVDTOILPDB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |