C12H22N2 — CID 143018944
ethane;1-N,1-N,4-N,2-tetramethylbenzene-1,4-diamine (PubChem CID 143018944) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is ethane;1-N,1-N,4-N,2-tetramethylbenzene-1,4-diamine.
| Compound Name | ethane;1-N,1-N,4-N,2-tetramethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 143018944 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | ethane;1-N,1-N,4-N,2-tetramethylbenzene-1,4-diamine |
| SMILES | CC.CNc1ccc(N(C)C)c(C)c1 |
| InChI | InChI=1S/C10H16N2.C2H6/c1-8-7-9(11-2)5-6-10(8)12(3)4;1-2/h5-7,11H,1-4H3;1-2H3 |
| InChIKey | UAZZZJIPLPOTTH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|