C11H14Cl3N — CID 98591830
4-chloro-N,N-bis(2-chloroethyl)-2-methylaniline (PubChem CID 98591830) has the molecular formula C11H14Cl3N and a molecular weight of 266.60 g/mol. Its IUPAC name is 4-chloro-N,N-bis(2-chloroethyl)-2-methylaniline.
| Compound Name | 4-chloro-N,N-bis(2-chloroethyl)-2-methylaniline |
|---|---|
| PubChem CID | 98591830 |
| Molecular Formula | C11H14Cl3N |
| Molecular Weight | 266.60 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 4-chloro-N,N-bis(2-chloroethyl)-2-methylaniline |
| SMILES | Cc1cc(Cl)ccc1N(CCCl)CCCl |
| InChI | InChI=1S/C11H14Cl3N/c1-9-8-10(14)2-3-11(9)15(6-4-12)7-5-13/h2-3,8H,4-7H2,1H3 |
| InChIKey | JIDNNXHVTBDACR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.60 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|