C10H13Cl3N2 — CID 10778263
2-chloro-1-N,1-N-bis(2-chloroethyl)benzene-1,4-diamine (PubChem CID 10778263) has the molecular formula C10H13Cl3N2 and a molecular weight of 267.59 g/mol. Its IUPAC name is 2-chloro-1-N,1-N-bis(2-chloroethyl)benzene-1,4-diamine.
| Compound Name | 2-chloro-1-N,1-N-bis(2-chloroethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 10778263 |
| Molecular Formula | C10H13Cl3N2 |
| Molecular Weight | 267.59 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 2-chloro-1-N,1-N-bis(2-chloroethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(N(CCCl)CCCl)c(Cl)c1 |
| InChI | InChI=1S/C10H13Cl3N2/c11-3-5-15(6-4-12)10-2-1-8(14)7-9(10)13/h1-2,7H,3-6,14H2 |
| InChIKey | JSTCZGJYUUOUJI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.59 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|